C30H25N3O3S — CID 23017098
(E)-N-(benzenesulfonyl)-3-[2-(naphthalen-2-ylmethyl)-4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 23017098) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-[2-(naphthalen-2-ylmethyl)-4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-[2-(naphthalen-2-ylmethyl)-4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 23017098 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-[2-(naphthalen-2-ylmethyl)-4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cn2cccn2)cc1Cc1ccc2ccccc2c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H25N3O3S/c34-30(32-37(35,36)29-9-2-1-3-10-29)16-15-26-14-12-24(22-33-18-6-17-31-33)21-28(26)20-23-11-13-25-7-4-5-8-27(25)19-23/h1-19,21H,20,22H2,(H,32,34)/b16-15+ |
| InChIKey | WMQGDDUHYMWHBP-FOCLMDBBSA-N |
| XLogP | 5.19 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|