C29H30N4O6S — CID 23017749
N-[2-[2-[3-(benzenesulfonamido)-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]-3-methoxybenzamide (PubChem CID 23017749) has the molecular formula C29H30N4O6S and a molecular weight of 562.65 g/mol. Its IUPAC name is N-[2-[2-[3-(benzenesulfonamido)-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[2-[3-(benzenesulfonamido)-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23017749 |
| Molecular Formula | C29H30N4O6S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | N-[2-[2-[3-(benzenesulfonamido)-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCOc2cc(Cn3cccn3)ccc2CCC(=O)NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H30N4O6S/c1-38-25-8-5-7-24(20-25)29(35)30-16-18-39-27-19-22(21-33-17-6-15-31-33)11-12-23(27)13-14-28(34)32-40(36,37)26-9-3-2-4-10-26/h2-12,15,17,19-20H,13-14,16,18,21H2,1H3,(H,30,35)(H,32,34) |
| InChIKey | PHKGHVODDHQHTB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|