C33H31F2N3O4S — CID 23017358
N-(3,4-difluorophenyl)sulfonyl-5-[2-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)phenyl]pentanamide (PubChem CID 23017358) has the molecular formula C33H31F2N3O4S and a molecular weight of 603.69 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)sulfonyl-5-[2-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)phenyl]pentanamide.
| Compound Name | N-(3,4-difluorophenyl)sulfonyl-5-[2-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 23017358 |
| Molecular Formula | C33H31F2N3O4S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | N-(3,4-difluorophenyl)sulfonyl-5-[2-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)phenyl]pentanamide |
| SMILES | O=C(CCCCc1ccc(Cn2cccn2)cc1OCCc1ccc2ccccc2c1)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C33H31F2N3O4S/c34-30-15-14-29(22-31(30)35)43(40,41)37-33(39)9-4-3-7-27-13-11-25(23-38-18-5-17-36-38)21-32(27)42-19-16-24-10-12-26-6-1-2-8-28(26)20-24/h1-2,5-6,8,10-15,17-18,20-22H,3-4,7,9,16,19,23H2,(H,37,39) |
| InChIKey | ILQILKMEFXJWLG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|