C29H29N5O8S — CID 23017405
3-methoxy-N-[2-[2-[3-[(3-nitrophenyl)sulfonylamino]-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]benzamide (PubChem CID 23017405) has the molecular formula C29H29N5O8S and a molecular weight of 607.65 g/mol. Its IUPAC name is 3-methoxy-N-[2-[2-[3-[(3-nitrophenyl)sulfonylamino]-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[2-[3-[(3-nitrophenyl)sulfonylamino]-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23017405 |
| Molecular Formula | C29H29N5O8S |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 3-methoxy-N-[2-[2-[3-[(3-nitrophenyl)sulfonylamino]-3-oxopropyl]-5-(pyrazol-1-ylmethyl)phenoxy]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCOc2cc(Cn3cccn3)ccc2CCC(=O)NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H29N5O8S/c1-41-25-7-2-5-23(18-25)29(36)30-14-16-42-27-17-21(20-33-15-4-13-31-33)9-10-22(27)11-12-28(35)32-43(39,40)26-8-3-6-24(19-26)34(37)38/h2-10,13,15,17-19H,11-12,14,16,20H2,1H3,(H,30,36)(H,32,35) |
| InChIKey | CQKAITCJPBUCGH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 171.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|