C22H20ClN3O6S — CID 39731277
N-[2-(3-chlorophenyl)ethyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide (PubChem CID 39731277) has the molecular formula C22H20ClN3O6S and a molecular weight of 489.94 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 39731277 |
| Molecular Formula | C22H20ClN3O6S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1cccc(C(=O)NCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H20ClN3O6S/c1-32-21-9-8-18(26(28)29)14-20(21)25-33(30,31)19-7-3-5-16(13-19)22(27)24-11-10-15-4-2-6-17(23)12-15/h2-9,12-14,25H,10-11H2,1H3,(H,24,27) |
| InChIKey | MWCUINUXPSBGRZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|