C26H27ClN4O6S — CID 166387283
N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide (PubChem CID 166387283) has the molecular formula C26H27ClN4O6S and a molecular weight of 559.04 g/mol. Its IUPAC name is N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide.
| Compound Name | N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 166387283 |
| Molecular Formula | C26H27ClN4O6S |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | N-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1cccc(C(=O)NCC2CCN(c3cc(Cl)ccc3C)C2)c1 |
| InChI | InChI=1S/C26H27ClN4O6S/c1-17-6-7-20(27)13-24(17)30-11-10-18(16-30)15-28-26(32)19-4-3-5-22(12-19)38(35,36)29-23-14-21(31(33)34)8-9-25(23)37-2/h3-9,12-14,18,29H,10-11,15-16H2,1-2H3,(H,28,32) |
| InChIKey | VYYYFUJZDDSLKK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|