C18H21ClN4O4S — CID 133275255
2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methylamino]-5-nitrobenzenesulfonamide (PubChem CID 133275255) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methylamino]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methylamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133275255 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[[1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methylamino]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1N1CCC(CNc2ccc([N+](=O)[O-])cc2S(N)(=O)=O)C1 |
| InChI | InChI=1S/C18H21ClN4O4S/c1-12-2-3-14(19)8-17(12)22-7-6-13(11-22)10-21-16-5-4-15(23(24)25)9-18(16)28(20,26)27/h2-5,8-9,13,21H,6-7,10-11H2,1H3,(H2,20,26,27) |
| InChIKey | FITDMCCDGCMDFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|