C12H19N5O4S — CID 133306085
2-[(3,5-dimethylpyrazolidin-4-yl)methylamino]-5-nitrobenzenesulfonamide (PubChem CID 133306085) has the molecular formula C12H19N5O4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[(3,5-dimethylpyrazolidin-4-yl)methylamino]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(3,5-dimethylpyrazolidin-4-yl)methylamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133306085 |
| Molecular Formula | C12H19N5O4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[(3,5-dimethylpyrazolidin-4-yl)methylamino]-5-nitrobenzenesulfonamide |
| SMILES | CC1NNC(C)C1CNc1ccc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H19N5O4S/c1-7-10(8(2)16-15-7)6-14-11-4-3-9(17(18)19)5-12(11)22(13,20)21/h3-5,7-8,10,14-16H,6H2,1-2H3,(H2,13,20,21) |
| InChIKey | NXKGRAZWVPGTIT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|