C10H15N3O4S — CID 62148765
2-(ethylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 62148765) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(ethylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-(ethylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62148765 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(ethylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H15N3O4S/c1-4-11-9-6-5-8(13(14)15)7-10(9)18(16,17)12(2)3/h5-7,11H,4H2,1-3H3 |
| InChIKey | IHGYDPQWAJPUFX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|