About 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide
2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 162727781) has the molecular formula C9H12N2O5S
and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| PubChem CID | 162727781 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1CO |
| InChI | InChI=1S/C9H12N2O5S/c1-10(2)17(15,16)9-5-8(11(13)14)4-3-7(9)6-12/h3-5,12H,6H2,1-2H3 |
| InChIKey | VPZTYDFABIPFKM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The IUPAC name of 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide (CID 162727781) is 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide.
What is the SMILES notation for 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The canonical SMILES for 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide is CN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1CO.
What is the InChIKey of 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The InChIKey is VPZTYDFABIPFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O5S/c1-10(2)17(15,16)9-5-8(11(13)14)4-3-7(9)6-12/h3-5,12H,6H2,1-2H3.
What are the key properties of 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide?
2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide has a molecular weight of 260.27 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide is sourced from PubChem (CID 162727781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).