C10H14N2O5S — CID 162727170
2-(2-hydroxyethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 162727170) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-(2-hydroxyethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162727170 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-(2-hydroxyethyl)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1CCO |
| InChI | InChI=1S/C10H14N2O5S/c1-11(2)18(16,17)10-7-9(12(14)15)4-3-8(10)5-6-13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | NPHMAUVHQTUGJE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|