C12H21ClN4O4S — CID 70466543
2-[3-amino-3-(dimethylamino)propyl]-N-methyl-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 70466543) has the molecular formula C12H21ClN4O4S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[3-amino-3-(dimethylamino)propyl]-N-methyl-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 2-[3-amino-3-(dimethylamino)propyl]-N-methyl-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 70466543 |
| Molecular Formula | C12H21ClN4O4S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[3-amino-3-(dimethylamino)propyl]-N-methyl-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1cc([N+](=O)[O-])ccc1CCC(N)N(C)C.Cl |
| InChI | InChI=1S/C12H20N4O4S.ClH/c1-14-21(19,20)11-8-10(16(17)18)6-4-9(11)5-7-12(13)15(2)3;/h4,6,8,12,14H,5,7,13H2,1-3H3;1H |
| InChIKey | BRMPNOYVJQQFSP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|