C16H17ClF3N3O4S — CID 140687947
2-[(2S)-2-amino-2-[3-(difluoromethyl)-4-fluorophenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 140687947) has the molecular formula C16H17ClF3N3O4S and a molecular weight of 439.84 g/mol. Its IUPAC name is 2-[(2S)-2-amino-2-[3-(difluoromethyl)-4-fluorophenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 2-[(2S)-2-amino-2-[3-(difluoromethyl)-4-fluorophenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 140687947 |
| Molecular Formula | C16H17ClF3N3O4S |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[(2S)-2-amino-2-[3-(difluoromethyl)-4-fluorophenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1C[C@H](N)c1ccc(F)c(C(F)F)c1.Cl |
| InChI | InChI=1S/C16H16F3N3O4S.ClH/c1-21-27(25,26)15-5-3-11(22(23)24)6-10(15)8-14(20)9-2-4-13(17)12(7-9)16(18)19;/h2-7,14,16,21H,8,20H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | CBWUGXJEJXDLBM-UQKRIMTDSA-N |
| XLogP | 3.24 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|