C15H16N4O6S — CID 55828205
methyl N-[4-[(4-nitro-2-sulfamoylanilino)methyl]phenyl]carbamate (PubChem CID 55828205) has the molecular formula C15H16N4O6S and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl N-[4-[(4-nitro-2-sulfamoylanilino)methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[(4-nitro-2-sulfamoylanilino)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55828205 |
| Molecular Formula | C15H16N4O6S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | methyl N-[4-[(4-nitro-2-sulfamoylanilino)methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNc2ccc([N+](=O)[O-])cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16N4O6S/c1-25-15(20)18-11-4-2-10(3-5-11)9-17-13-7-6-12(19(21)22)8-14(13)26(16,23)24/h2-8,17H,9H2,1H3,(H,18,20)(H2,16,23,24) |
| InChIKey | CCVALSLVQCESBK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|