C21H21N3O7S — CID 4965232
3-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 4965232) has the molecular formula C21H21N3O7S and a molecular weight of 459.48 g/mol. Its IUPAC name is 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4965232 |
| Molecular Formula | C21H21N3O7S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 3-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1cccc(C(=O)N(C)Cc2ccc(C)o2)c1 |
| InChI | InChI=1S/C21H21N3O7S/c1-14-7-9-17(31-14)13-23(2)21(25)15-5-4-6-18(11-15)32(28,29)22-19-12-16(24(26)27)8-10-20(19)30-3/h4-12,22H,13H2,1-3H3 |
| InChIKey | ZSQRYEHEVVPCBK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|