C27H24BrN3O4S — CID 23017029
(E)-3-[2-benzyl-4-(pyrazol-1-ylmethyl)phenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide (PubChem CID 23017029) has the molecular formula C27H24BrN3O4S and a molecular weight of 566.48 g/mol. Its IUPAC name is (E)-3-[2-benzyl-4-(pyrazol-1-ylmethyl)phenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[2-benzyl-4-(pyrazol-1-ylmethyl)phenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 23017029 |
| Molecular Formula | C27H24BrN3O4S |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | (E)-3-[2-benzyl-4-(pyrazol-1-ylmethyl)phenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(=O)/C=C/c1ccc(Cn2cccn2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C27H24BrN3O4S/c1-35-25-12-11-24(28)18-26(25)36(33,34)30-27(32)13-10-22-9-8-21(19-31-15-5-14-29-31)17-23(22)16-20-6-3-2-4-7-20/h2-15,17-18H,16,19H2,1H3,(H,30,32)/b13-10+ |
| InChIKey | KZJPCLIMFGEABU-JLHYYAGUSA-N |
| XLogP | 4.81 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|