C25H19BrFNO4S2 — CID 21198667
(E)-3-[2-(1-benzothiophen-2-ylmethyl)-5-fluorophenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide (PubChem CID 21198667) has the molecular formula C25H19BrFNO4S2 and a molecular weight of 560.47 g/mol. Its IUPAC name is (E)-3-[2-(1-benzothiophen-2-ylmethyl)-5-fluorophenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[2-(1-benzothiophen-2-ylmethyl)-5-fluorophenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 21198667 |
| Molecular Formula | C25H19BrFNO4S2 |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 558.99 |
| IUPAC Name | (E)-3-[2-(1-benzothiophen-2-ylmethyl)-5-fluorophenyl]-N-(5-bromo-2-methoxyphenyl)sulfonylprop-2-enamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(=O)/C=C/c1cc(F)ccc1Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C25H19BrFNO4S2/c1-32-22-10-8-19(26)15-24(22)34(30,31)28-25(29)11-7-16-12-20(27)9-6-17(16)13-21-14-18-4-2-3-5-23(18)33-21/h2-12,14-15H,13H2,1H3,(H,28,29)/b11-7+ |
| InChIKey | AXGJHKXUQMEJMJ-YRNVUSSQSA-N |
| XLogP | 5.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|