C21H21N3O2 — CID 46424056
(E)-3-(2-methoxy-5-methylphenyl)-N-[3-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 46424056) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (E)-3-(2-methoxy-5-methylphenyl)-N-[3-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxy-5-methylphenyl)-N-[3-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46424056 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (E)-3-(2-methoxy-5-methylphenyl)-N-[3-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C)cc1/C=C/C(=O)Nc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-16-7-9-20(26-2)18(13-16)8-10-21(25)23-19-6-3-5-17(14-19)15-24-12-4-11-22-24/h3-14H,15H2,1-2H3,(H,23,25)/b10-8+ |
| InChIKey | MPRADQXOOKUANO-CSKARUKUSA-N |
| XLogP | 3.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|