C19H20N4S — CID 17284941
1-(3,5-dimethylphenyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea (PubChem CID 17284941) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17284941 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2cccc(Cn3cccn3)c2)c1 |
| InChI | InChI=1S/C19H20N4S/c1-14-9-15(2)11-18(10-14)22-19(24)21-17-6-3-5-16(12-17)13-23-8-4-7-20-23/h3-12H,13H2,1-2H3,(H2,21,22,24) |
| InChIKey | HEEFBSBZVFHUAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|