C18H17FN4S — CID 970237
1-[(4-fluorophenyl)methyl]-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea (PubChem CID 970237) has the molecular formula C18H17FN4S and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 970237 |
| Molecular Formula | C18H17FN4S |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-(pyrazol-1-ylmethyl)phenyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)Nc2cccc(Cn3cccn3)c2)cc1 |
| InChI | InChI=1S/C18H17FN4S/c19-16-7-5-14(6-8-16)12-20-18(24)22-17-4-1-3-15(11-17)13-23-10-2-9-21-23/h1-11H,12-13H2,(H2,20,22,24) |
| InChIKey | SLWQLAMHZSEUPS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|