C29H29N3O3 — CID 19336206
(E)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 19336206) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19336206 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cnn(Cc3cccc(C)c3)c2)cc1COc1ccc(C)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-21-7-11-27(12-8-21)35-20-25-16-23(9-13-28(25)34-3)10-14-29(33)31-26-17-30-32(19-26)18-24-6-4-5-22(2)15-24/h4-17,19H,18,20H2,1-3H3,(H,31,33)/b14-10+ |
| InChIKey | WGONXVLEHXAVCF-GXDHUFHOSA-N |
| XLogP | 5.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|