C23H25N3O4 — CID 19340508
(E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide (PubChem CID 19340508) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19340508 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
| SMILES | CCOCn1cc(NC(=O)/C=C/c2ccc(OC)c(COc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C23H25N3O4/c1-3-29-17-26-15-20(14-24-26)25-23(27)12-10-18-9-11-22(28-2)19(13-18)16-30-21-7-5-4-6-8-21/h4-15H,3,16-17H2,1-2H3,(H,25,27)/b12-10+ |
| InChIKey | OIHMLJXNOWXSAR-ZRDIBKRKSA-N |
| XLogP | 4.12 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|