C25H28N4O4 — CID 19396217
4-[[(E)-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enoyl]amino]-1-methyl-N-propylpyrazole-5-carboxamide (PubChem CID 19396217) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[[(E)-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enoyl]amino]-1-methyl-N-propylpyrazole-5-carboxamide.
| Compound Name | 4-[[(E)-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enoyl]amino]-1-methyl-N-propylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19396217 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-[[(E)-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enoyl]amino]-1-methyl-N-propylpyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1c(NC(=O)/C=C/c2ccc(OC)c(COc3ccccc3)c2)cnn1C |
| InChI | InChI=1S/C25H28N4O4/c1-4-14-26-25(31)24-21(16-27-29(24)2)28-23(30)13-11-18-10-12-22(32-3)19(15-18)17-33-20-8-6-5-7-9-20/h5-13,15-16H,4,14,17H2,1-3H3,(H,26,31)(H,28,30)/b13-11+ |
| InChIKey | RZJCEAXOQIULNM-ACCUITESSA-N |
| XLogP | 3.80 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|