C28H26FN3O3 — CID 19409568
(E)-N-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide (PubChem CID 19409568) has the molecular formula C28H26FN3O3 and a molecular weight of 471.53 g/mol. Its IUPAC name is (E)-N-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19409568 |
| Molecular Formula | C28H26FN3O3 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (E)-N-[1-[(2-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(C)n(Cc3ccccc3F)n2)cc1COc1ccccc1 |
| InChI | InChI=1S/C28H26FN3O3/c1-20-16-27(31-32(20)18-22-8-6-7-11-25(22)29)30-28(33)15-13-21-12-14-26(34-2)23(17-21)19-35-24-9-4-3-5-10-24/h3-17H,18-19H2,1-2H3,(H,30,31,33)/b15-13+ |
| InChIKey | MYNIYLZOQILLAX-FYWRMAATSA-N |
| XLogP | 5.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|