C29H24F5N3O3 — CID 19401969
(E)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide (PubChem CID 19401969) has the molecular formula C29H24F5N3O3 and a molecular weight of 557.52 g/mol. Its IUPAC name is (E)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19401969 |
| Molecular Formula | C29H24F5N3O3 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | (E)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)cc1COc1ccccc1 |
| InChI | InChI=1S/C29H24F5N3O3/c1-16-29(17(2)37(36-16)14-21-24(30)26(32)28(34)27(33)25(21)31)35-23(38)12-10-18-9-11-22(39-3)19(13-18)15-40-20-7-5-4-6-8-20/h4-13H,14-15H2,1-3H3,(H,35,38)/b12-10+ |
| InChIKey | LHGVIABEKSNZND-ZRDIBKRKSA-N |
| XLogP | 6.48 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|