C16H19N3O3 — CID 19340489
(E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 19340489) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19340489 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (E)-N-[1-(ethoxymethyl)pyrazol-4-yl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCOCn1cc(NC(=O)/C=C/c2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-22-12-19-11-14(10-17-19)18-16(20)9-6-13-4-7-15(21-2)8-5-13/h4-11H,3,12H2,1-2H3,(H,18,20)/b9-6+ |
| InChIKey | OZKPMXNGYPRUKG-RMKNXTFCSA-N |
| XLogP | 2.54 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|