C19H17BrN4O2 — CID 55856398
(E)-N-(1-benzyl-1,2,4-triazol-3-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 55856398) has the molecular formula C19H17BrN4O2 and a molecular weight of 413.28 g/mol. Its IUPAC name is (E)-N-(1-benzyl-1,2,4-triazol-3-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1-benzyl-1,2,4-triazol-3-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55856398 |
| Molecular Formula | C19H17BrN4O2 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | (E)-N-(1-benzyl-1,2,4-triazol-3-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H17BrN4O2/c1-26-17-9-8-16(20)11-15(17)7-10-18(25)22-19-21-13-24(23-19)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,23,25)/b10-7+ |
| InChIKey | ABKKSZCPWPBNMI-JXMROGBWSA-N |
| XLogP | 3.75 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|