C28H23NO4 — CID 23016735
(E)-3-[2-(2-naphthalen-2-ylethoxy)-4-(phenylcarbamoyl)phenyl]prop-2-enoic acid (PubChem CID 23016735) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-3-[2-(2-naphthalen-2-ylethoxy)-4-(phenylcarbamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2-naphthalen-2-ylethoxy)-4-(phenylcarbamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23016735 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (E)-3-[2-(2-naphthalen-2-ylethoxy)-4-(phenylcarbamoyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)Nc2ccccc2)cc1OCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H23NO4/c30-27(31)15-14-22-12-13-24(28(32)29-25-8-2-1-3-9-25)19-26(22)33-17-16-20-10-11-21-6-4-5-7-23(21)18-20/h1-15,18-19H,16-17H2,(H,29,32)(H,30,31)/b15-14+ |
| InChIKey | DAZSISWMTCUANG-CCEZHUSRSA-N |
| XLogP | 5.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|