C24H19F2NO4 — CID 11855841
(E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-(2-phenylethoxy)phenyl]prop-2-enoic acid (PubChem CID 11855841) has the molecular formula C24H19F2NO4 and a molecular weight of 423.42 g/mol. Its IUPAC name is (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-(2-phenylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-(2-phenylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11855841 |
| Molecular Formula | C24H19F2NO4 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-(2-phenylethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)Nc2cc(F)ccc2F)cc1OCCc1ccccc1 |
| InChI | InChI=1S/C24H19F2NO4/c25-19-9-10-20(26)21(15-19)27-24(30)18-7-6-17(8-11-23(28)29)22(14-18)31-13-12-16-4-2-1-3-5-16/h1-11,14-15H,12-13H2,(H,27,30)(H,28,29)/b11-8+ |
| InChIKey | HRWCZEDPXBVXQU-DHZHZOJOSA-N |
| XLogP | 4.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|