C25H22F2N2O4 — CID 11855840
(E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-[2-(N-methylanilino)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 11855840) has the molecular formula C25H22F2N2O4 and a molecular weight of 452.46 g/mol. Its IUPAC name is (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-[2-(N-methylanilino)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-[2-(N-methylanilino)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11855840 |
| Molecular Formula | C25H22F2N2O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (E)-3-[4-[(2,5-difluorophenyl)carbamoyl]-2-[2-(N-methylanilino)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CN(CCOc1cc(C(=O)Nc2cc(F)ccc2F)ccc1/C=C/C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H22F2N2O4/c1-29(20-5-3-2-4-6-20)13-14-33-23-15-18(8-7-17(23)9-12-24(30)31)25(32)28-22-16-19(26)10-11-21(22)27/h2-12,15-16H,13-14H2,1H3,(H,28,32)(H,30,31)/b12-9+ |
| InChIKey | NICBZMNLSBDNNB-FMIVXFBMSA-N |
| XLogP | 4.83 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|