C29H25NO4 — CID 11855564
(E)-3-[4-[(4-methylphenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 11855564) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is (E)-3-[4-[(4-methylphenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(4-methylphenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11855564 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (E)-3-[4-[(4-methylphenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(/C=C/C(=O)O)c(OCCc3ccc4ccccc4c3)c2)cc1 |
| InChI | InChI=1S/C29H25NO4/c1-20-6-13-26(14-7-20)30-29(33)25-11-10-23(12-15-28(31)32)27(19-25)34-17-16-21-8-9-22-4-2-3-5-24(22)18-21/h2-15,18-19H,16-17H2,1H3,(H,30,33)(H,31,32)/b15-12+ |
| InChIKey | UNZSNDDXISMOKT-NTCAYCPXSA-N |
| XLogP | 6.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|