C29H22N2O4 — CID 11855838
(E)-3-[4-[(3-cyanophenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 11855838) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is (E)-3-[4-[(3-cyanophenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-cyanophenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11855838 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (E)-3-[4-[(3-cyanophenyl)carbamoyl]-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(/C=C/C(=O)O)c(OCCc3ccc4ccccc4c3)c2)c1 |
| InChI | InChI=1S/C29H22N2O4/c30-19-21-4-3-7-26(17-21)31-29(34)25-11-10-23(12-13-28(32)33)27(18-25)35-15-14-20-8-9-22-5-1-2-6-24(22)16-20/h1-13,16-18H,14-15H2,(H,31,34)(H,32,33)/b13-12+ |
| InChIKey | WBGZUXUXLFLLRI-OUKQBFOZSA-N |
| XLogP | 5.68 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|