C11H10N2O2S — CID 76918091
3-[2-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76918091) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-[2-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918091 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-[2-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccsc1Cn1cccn1 |
| InChI | InChI=1S/C11H10N2O2S/c14-11(15)3-2-9-4-7-16-10(9)8-13-6-1-5-12-13/h1-7H,8H2,(H,14,15) |
| InChIKey | GEVGBPSCPOTCLP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|