C24H15ClF4N2O4S — CID 44564991
(E)-3-[4-(4-chloro-2-fluorophenoxy)-1-methylindol-3-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide (PubChem CID 44564991) has the molecular formula C24H15ClF4N2O4S and a molecular weight of 538.91 g/mol. Its IUPAC name is (E)-3-[4-(4-chloro-2-fluorophenoxy)-1-methylindol-3-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[4-(4-chloro-2-fluorophenoxy)-1-methylindol-3-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 44564991 |
| Molecular Formula | C24H15ClF4N2O4S |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | (E)-3-[4-(4-chloro-2-fluorophenoxy)-1-methylindol-3-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)NS(=O)(=O)c2cc(F)c(F)cc2F)c2c(Oc3ccc(Cl)cc3F)cccc21 |
| InChI | InChI=1S/C24H15ClF4N2O4S/c1-31-12-13(5-8-23(32)30-36(33,34)22-11-16(27)15(26)10-18(22)29)24-19(31)3-2-4-21(24)35-20-7-6-14(25)9-17(20)28/h2-12H,1H3,(H,30,32)/b8-5+ |
| InChIKey | MNDBWMVLUHQMEA-VMPITWQZSA-N |
| XLogP | 5.70 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|