C24H16Cl2F2N2O4S — CID 44564571
(E)-3-[4-(3,4-dichlorophenoxy)-1-methylindol-3-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide (PubChem CID 44564571) has the molecular formula C24H16Cl2F2N2O4S and a molecular weight of 537.37 g/mol. Its IUPAC name is (E)-3-[4-(3,4-dichlorophenoxy)-1-methylindol-3-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[4-(3,4-dichlorophenoxy)-1-methylindol-3-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 44564571 |
| Molecular Formula | C24H16Cl2F2N2O4S |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | (E)-3-[4-(3,4-dichlorophenoxy)-1-methylindol-3-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)NS(=O)(=O)c2ccc(F)c(F)c2)c2c(Oc3ccc(Cl)c(Cl)c3)cccc21 |
| InChI | InChI=1S/C24H16Cl2F2N2O4S/c1-30-13-14(5-10-23(31)29-35(32,33)16-7-9-19(27)20(28)12-16)24-21(30)3-2-4-22(24)34-15-6-8-17(25)18(26)11-15/h2-13H,1H3,(H,29,31)/b10-5+ |
| InChIKey | DCKNNFTZFHMFSY-BJMVGYQFSA-N |
| XLogP | 6.07 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|