C26H19Cl2NO5S — CID 53473480
3-(3,4-dichlorophenyl)-N-[4-(2-methoxyphenoxy)phenyl]sulfonylbenzamide (PubChem CID 53473480) has the molecular formula C26H19Cl2NO5S and a molecular weight of 528.41 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[4-(2-methoxyphenoxy)phenyl]sulfonylbenzamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[4-(2-methoxyphenoxy)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 53473480 |
| Molecular Formula | C26H19Cl2NO5S |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[4-(2-methoxyphenoxy)phenyl]sulfonylbenzamide |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)NC(=O)c2cccc(-c3ccc(Cl)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C26H19Cl2NO5S/c1-33-24-7-2-3-8-25(24)34-20-10-12-21(13-11-20)35(31,32)29-26(30)19-6-4-5-17(15-19)18-9-14-22(27)23(28)16-18/h2-16H,1H3,(H,29,30) |
| InChIKey | ALGDADFQFCMFIE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |