C16H16NO6S- — CID 7045621
(2R)-2-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]propanoate (PubChem CID 7045621) has the molecular formula C16H16NO6S- and a molecular weight of 350.37 g/mol. Its IUPAC name is (2R)-2-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]propanoate.
| Compound Name | (2R)-2-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7045621 |
| Molecular Formula | C16H16NO6S- |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (2R)-2-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]propanoate |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)N[C@H](C)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO6S/c1-11(16(18)19)17-24(20,21)13-9-7-12(8-10-13)23-15-6-4-3-5-14(15)22-2/h3-11,17H,1-2H3,(H,18,19)/p-1/t11-/m1/s1 |
| InChIKey | QUWHLOBHPRYVHJ-LLVKDONJSA-M |
| XLogP | 0.90 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |