C15H14FNO5S — CID 75401968
N-(3,4-dimethoxyphenyl)sulfonyl-3-fluorobenzamide (PubChem CID 75401968) has the molecular formula C15H14FNO5S and a molecular weight of 339.34 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)sulfonyl-3-fluorobenzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)sulfonyl-3-fluorobenzamide |
|---|---|
| PubChem CID | 75401968 |
| Molecular Formula | C15H14FNO5S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)sulfonyl-3-fluorobenzamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C15H14FNO5S/c1-21-13-7-6-12(9-14(13)22-2)23(19,20)17-15(18)10-4-3-5-11(16)8-10/h3-9H,1-2H3,(H,17,18) |
| InChIKey | MAUNBOGHEVXBOI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |