C17H15F2NO5S — CID 91942457
3-(2,6-difluorophenyl)-N-(3,4-dimethoxyphenyl)sulfonylprop-2-enamide (PubChem CID 91942457) has the molecular formula C17H15F2NO5S and a molecular weight of 383.37 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-(3,4-dimethoxyphenyl)sulfonylprop-2-enamide.
| Compound Name | 3-(2,6-difluorophenyl)-N-(3,4-dimethoxyphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 91942457 |
| Molecular Formula | C17H15F2NO5S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-(3,4-dimethoxyphenyl)sulfonylprop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)C=Cc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C17H15F2NO5S/c1-24-15-8-6-11(10-16(15)25-2)26(22,23)20-17(21)9-7-12-13(18)4-3-5-14(12)19/h3-10H,1-2H3,(H,20,21) |
| InChIKey | BTIUZHLBPUXBPK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|