C17H14FNO5S — CID 91942392
N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 91942392) has the molecular formula C17H14FNO5S and a molecular weight of 363.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91942392 |
| Molecular Formula | C17H14FNO5S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1F)NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H14FNO5S/c18-14-4-2-1-3-12(14)5-8-17(20)19-25(21,22)13-6-7-15-16(11-13)24-10-9-23-15/h1-8,11H,9-10H2,(H,19,20) |
| InChIKey | UYKXAMMOCOBNQL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|