C15H17NO5S — CID 126802014
3-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)but-2-enamide (PubChem CID 126802014) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)but-2-enamide.
| Compound Name | 3-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)but-2-enamide |
|---|---|
| PubChem CID | 126802014 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)but-2-enamide |
| SMILES | CC(=CC(=O)NS(=O)(=O)c1ccc2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C15H17NO5S/c1-10(11-2-3-11)8-15(17)16-22(18,19)12-4-5-13-14(9-12)21-7-6-20-13/h4-5,8-9,11H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | YGFLWBSFIFPDGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|