C17H14ClNO5S — CID 71894493
3-(3-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)prop-2-enamide (PubChem CID 71894493) has the molecular formula C17H14ClNO5S and a molecular weight of 379.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)prop-2-enamide |
|---|---|
| PubChem CID | 71894493 |
| Molecular Formula | C17H14ClNO5S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1)NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H14ClNO5S/c18-13-3-1-2-12(10-13)4-7-17(20)19-25(21,22)14-5-6-15-16(11-14)24-9-8-23-15/h1-7,10-11H,8-9H2,(H,19,20) |
| InChIKey | ILRORPMNEQDQGA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|