C24H22N2O5S — CID 55349221
(E)-N-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)phenyl]-3-(3-methylphenyl)prop-2-enamide (PubChem CID 55349221) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is (E)-N-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)phenyl]-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)phenyl]-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55349221 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (E)-N-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)phenyl]-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)Nc2ccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)cc2)c1 |
| InChI | InChI=1S/C24H22N2O5S/c1-17-3-2-4-18(15-17)5-12-24(27)25-19-6-8-20(9-7-19)26-32(28,29)21-10-11-22-23(16-21)31-14-13-30-22/h2-12,15-16,26H,13-14H2,1H3,(H,25,27)/b12-5+ |
| InChIKey | RZDCWHPCPDJTOT-LFYBBSHMSA-N |
| XLogP | 4.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|