C16H15FN2O5S — CID 8523930
N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-fluorobenzohydrazide (PubChem CID 8523930) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-fluorobenzohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 8523930 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-fluorobenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)OCCCO2)c1ccccc1F |
| InChI | InChI=1S/C16H15FN2O5S/c17-13-5-2-1-4-12(13)16(20)18-19-25(21,22)11-6-7-14-15(10-11)24-9-3-8-23-14/h1-2,4-7,10,19H,3,8-9H2,(H,18,20) |
| InChIKey | ILGLSTLOGDTNJH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|