C18H20N2O6S — CID 8617321
N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-ethoxybenzohydrazide (PubChem CID 8617321) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-ethoxybenzohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 8617321 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-4-ethoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNS(=O)(=O)c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C18H20N2O6S/c1-2-24-14-6-4-13(5-7-14)18(21)19-20-27(22,23)15-8-9-16-17(12-15)26-11-3-10-25-16/h4-9,12,20H,2-3,10-11H2,1H3,(H,19,21) |
| InChIKey | BIDYGNQZSCWSAZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|