C19H17N3O5S — CID 31324308
N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)quinoline-2-carbohydrazide (PubChem CID 31324308) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)quinoline-2-carbohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 31324308 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)quinoline-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)OCCCO2)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H17N3O5S/c23-19(16-8-6-13-4-1-2-5-15(13)20-16)21-22-28(24,25)14-7-9-17-18(12-14)27-11-3-10-26-17/h1-2,4-9,12,22H,3,10-11H2,(H,21,23) |
| InChIKey | ZWHPYOSASZJMSJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|