C13H12N2O6S — CID 8616849
N'-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)furan-2-carbohydrazide (PubChem CID 8616849) has the molecular formula C13H12N2O6S and a molecular weight of 324.31 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)furan-2-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8616849 |
| Molecular Formula | C13H12N2O6S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)OCCO2)c1ccco1 |
| InChI | InChI=1S/C13H12N2O6S/c16-13(11-2-1-5-19-11)14-15-22(17,18)9-3-4-10-12(8-9)21-7-6-20-10/h1-5,8,15H,6-7H2,(H,14,16) |
| InChIKey | VHCPGLHKFJEYSG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|