C16H17FN2O4S — CID 155019251
N'-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonohydrazide (PubChem CID 155019251) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is N'-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonohydrazide.
| Compound Name | N'-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonohydrazide |
|---|---|
| PubChem CID | 155019251 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N'-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonohydrazide |
| SMILES | O=S(=O)(NNCc1ccccc1F)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C16H17FN2O4S/c17-14-5-2-1-4-12(14)11-18-19-24(20,21)13-6-7-15-16(10-13)23-9-3-8-22-15/h1-2,4-7,10,18-19H,3,8-9,11H2 |
| InChIKey | GRQPOMLDHVFRRZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|