C25H23FN2O5S — CID 55976656
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylbenzamide (PubChem CID 55976656) has the molecular formula C25H23FN2O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55976656 |
| Molecular Formula | C25H23FN2O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C25H23FN2O5S/c1-2-13-28(17-19-5-3-4-6-22(19)26)25(29)18-7-9-20(10-8-18)27-34(30,31)21-11-12-23-24(16-21)33-15-14-32-23/h2-12,16,27H,1,13-15,17H2 |
| InChIKey | GTDIDMZTDXPSAR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|