C21H25FN2O5S2 — CID 55381565
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 55381565) has the molecular formula C21H25FN2O5S2 and a molecular weight of 468.57 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55381565 |
| Molecular Formula | C21H25FN2O5S2 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)OCCCO2)NCCSCc1ccccc1F |
| InChI | InChI=1S/C21H25FN2O5S2/c22-18-5-2-1-4-16(18)15-30-13-10-23-21(25)8-9-24-31(26,27)17-6-7-19-20(14-17)29-12-3-11-28-19/h1-2,4-7,14,24H,3,8-13,15H2,(H,23,25) |
| InChIKey | ZVMAUVPOJQPTER-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|